C29H28N2O4 — CID 10552237
(E)-3-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-4-phenylmethoxyindol-3-yl]prop-2-enoic acid (PubChem CID 10552237) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is (E)-3-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-4-phenylmethoxyindol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-4-phenylmethoxyindol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10552237 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (E)-3-[1-[2-[methyl(2-phenylethyl)amino]-2-oxoethyl]-4-phenylmethoxyindol-3-yl]prop-2-enoic acid |
| SMILES | CN(CCc1ccccc1)C(=O)Cn1cc(/C=C/C(=O)O)c2c(OCc3ccccc3)cccc21 |
| InChI | InChI=1S/C29H28N2O4/c1-30(18-17-22-9-4-2-5-10-22)27(32)20-31-19-24(15-16-28(33)34)29-25(31)13-8-14-26(29)35-21-23-11-6-3-7-12-23/h2-16,19H,17-18,20-21H2,1H3,(H,33,34)/b16-15+ |
| InChIKey | BJIMMNXYKBLIIP-FOCLMDBBSA-N |
| XLogP | 5.02 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|