C15H12F2O8S2 — CID 129070768
2-[4-(benzenesulfonyloxy)benzoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 129070768) has the molecular formula C15H12F2O8S2 and a molecular weight of 422.38 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyloxy)benzoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[4-(benzenesulfonyloxy)benzoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 129070768 |
| Molecular Formula | C15H12F2O8S2 |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 2-[4-(benzenesulfonyloxy)benzoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12F2O8S2/c16-15(17,27(21,22)23)10-24-14(18)11-6-8-12(9-7-11)25-26(19,20)13-4-2-1-3-5-13/h1-9H,10H2,(H,21,22,23) |
| InChIKey | XYBSAOYWGQAIMI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|