C26H34N2O2 — CID 129071075
N-[2-[[(2S)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]-1-phenylethyl]benzamide (PubChem CID 129071075) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is N-[2-[[(2S)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]-1-phenylethyl]benzamide.
| Compound Name | N-[2-[[(2S)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 129071075 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | N-[2-[[(2S)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]-1-phenylethyl]benzamide |
| SMILES | CC1CC[C@@H](C(C)C)C(C(=O)NCC(NC(=O)c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H34N2O2/c1-18(2)22-15-14-19(3)16-23(22)26(30)27-17-24(20-10-6-4-7-11-20)28-25(29)21-12-8-5-9-13-21/h4-13,18-19,22-24H,14-17H2,1-3H3,(H,27,30)(H,28,29)/t19?,22-,23?,24?/m0/s1 |
| InChIKey | LKGXWIGJXUHCIR-PPLUZJJNSA-N |
| XLogP | 4.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |