About 5-chloro-6-methylpyrazine-2,3-dicarbonitrile
5-chloro-6-methylpyrazine-2,3-dicarbonitrile (PubChem CID 12907198) has the molecular formula C7H3ClN4
and a molecular weight of 178.58 g/mol. Its IUPAC name is 5-chloro-6-methylpyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-chloro-6-methylpyrazine-2,3-dicarbonitrile |
| PubChem CID | 12907198 |
| Molecular Formula | C7H3ClN4 |
| Molecular Weight | 178.58 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | 5-chloro-6-methylpyrazine-2,3-dicarbonitrile |
| SMILES | Cc1nc(C#N)c(C#N)nc1Cl |
| InChI | InChI=1S/C7H3ClN4/c1-4-7(8)12-6(3-10)5(2-9)11-4/h1H3 |
| InChIKey | FMSRCHYXAOIQFU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-6-methylpyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-methylpyrazine-2,3-dicarbonitrile?
The IUPAC name of 5-chloro-6-methylpyrazine-2,3-dicarbonitrile (CID 12907198) is 5-chloro-6-methylpyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 5-chloro-6-methylpyrazine-2,3-dicarbonitrile?
The canonical SMILES for 5-chloro-6-methylpyrazine-2,3-dicarbonitrile is Cc1nc(C#N)c(C#N)nc1Cl.
What is the InChIKey of 5-chloro-6-methylpyrazine-2,3-dicarbonitrile?
The InChIKey is FMSRCHYXAOIQFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN4/c1-4-7(8)12-6(3-10)5(2-9)11-4/h1H3.
What are the key properties of 5-chloro-6-methylpyrazine-2,3-dicarbonitrile?
5-chloro-6-methylpyrazine-2,3-dicarbonitrile has a molecular weight of 178.58 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-methylpyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 12907198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).