C6Cl2N4 — CID 607820
5,6-dichloropyrazine-2,3-dicarbonitrile (PubChem CID 607820) has the molecular formula C6Cl2N4 and a molecular weight of 199.00 g/mol. Its IUPAC name is 5,6-dichloropyrazine-2,3-dicarbonitrile.
| Compound Name | 5,6-dichloropyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 607820 |
| Molecular Formula | C6Cl2N4 |
| Molecular Weight | 199.00 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | 5,6-dichloropyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1nc(Cl)c(Cl)nc1C#N |
| InChI | InChI=1S/C6Cl2N4/c7-5-6(8)12-4(2-10)3(1-9)11-5 |
| InChIKey | QUFXYBKGILUJHS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.00 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |