C5Cl3N3 — CID 84819884
3,5,6-trichloropyrazine-2-carbonitrile (PubChem CID 84819884) has the molecular formula C5Cl3N3 and a molecular weight of 208.44 g/mol. Its IUPAC name is 3,5,6-trichloropyrazine-2-carbonitrile.
| Compound Name | 3,5,6-trichloropyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 84819884 |
| Molecular Formula | C5Cl3N3 |
| Molecular Weight | 208.44 g/mol |
| Exact Mass | 206.92 |
| IUPAC Name | 3,5,6-trichloropyrazine-2-carbonitrile |
| SMILES | N#Cc1nc(Cl)c(Cl)nc1Cl |
| InChI | InChI=1S/C5Cl3N3/c6-3-2(1-9)10-4(7)5(8)11-3 |
| InChIKey | VSLWHOCGIKPSJC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |