About CID 89081662
CID 89081662 (PubChem CID 89081662) has the molecular formula C6H3BCl2N3
and a molecular weight of 198.83 g/mol.
Molecular Properties
| Compound Name | CID 89081662 |
| PubChem CID | 89081662 |
| Molecular Formula | C6H3BCl2N3 |
| Molecular Weight | 198.83 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | — |
| SMILES | C[B]c1nc(Cl)c(C#N)nc1Cl |
| InChI | InChI=1S/C6H3BCl2N3/c1-7-4-6(9)11-3(2-10)5(8)12-4/h1H3 |
| InChIKey | KKJJCZUUOMMMFW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.83 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89081662 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89081662?
The IUPAC name of CID 89081662 (CID 89081662) is not available.
What is the SMILES notation for CID 89081662?
The canonical SMILES for CID 89081662 is C[B]c1nc(Cl)c(C#N)nc1Cl.
What is the InChIKey of CID 89081662?
The InChIKey is KKJJCZUUOMMMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BCl2N3/c1-7-4-6(9)11-3(2-10)5(8)12-4/h1H3.
What are the key properties of CID 89081662?
CID 89081662 has a molecular weight of 198.83 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89081662 is sourced from PubChem (CID 89081662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).