About 3-bromo-5,6-dichloropyrazine-2-carbonitrile
3-bromo-5,6-dichloropyrazine-2-carbonitrile (PubChem CID 46835190) has the molecular formula C5BrCl2N3
and a molecular weight of 252.89 g/mol. Its IUPAC name is 3-bromo-5,6-dichloropyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-bromo-5,6-dichloropyrazine-2-carbonitrile |
| PubChem CID | 46835190 |
| Molecular Formula | C5BrCl2N3 |
| Molecular Weight | 252.89 g/mol |
| Exact Mass | 250.87 |
| IUPAC Name | 3-bromo-5,6-dichloropyrazine-2-carbonitrile |
| SMILES | N#Cc1nc(Cl)c(Cl)nc1Br |
| InChI | InChI=1S/C5BrCl2N3/c6-3-2(1-9)10-4(7)5(8)11-3 |
| InChIKey | BHWRGJWWVLGYLK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.89 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-5,6-dichloropyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5,6-dichloropyrazine-2-carbonitrile?
The IUPAC name of 3-bromo-5,6-dichloropyrazine-2-carbonitrile (CID 46835190) is 3-bromo-5,6-dichloropyrazine-2-carbonitrile.
What is the SMILES notation for 3-bromo-5,6-dichloropyrazine-2-carbonitrile?
The canonical SMILES for 3-bromo-5,6-dichloropyrazine-2-carbonitrile is N#Cc1nc(Cl)c(Cl)nc1Br.
What is the InChIKey of 3-bromo-5,6-dichloropyrazine-2-carbonitrile?
The InChIKey is BHWRGJWWVLGYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5BrCl2N3/c6-3-2(1-9)10-4(7)5(8)11-3.
What are the key properties of 3-bromo-5,6-dichloropyrazine-2-carbonitrile?
3-bromo-5,6-dichloropyrazine-2-carbonitrile has a molecular weight of 252.89 g/mol, XLogP of 2.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5,6-dichloropyrazine-2-carbonitrile is sourced from PubChem (CID 46835190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).