C24H28N4O3 — CID 129072510
(E)-N-[3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropoxy]phenyl]-2-methyl-3-[(methylideneamino)methylideneamino]prop-2-enamide (PubChem CID 129072510) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (E)-N-[3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropoxy]phenyl]-2-methyl-3-[(methylideneamino)methylideneamino]prop-2-enamide.
| Compound Name | (E)-N-[3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropoxy]phenyl]-2-methyl-3-[(methylideneamino)methylideneamino]prop-2-enamide |
|---|---|
| PubChem CID | 129072510 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (E)-N-[3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropoxy]phenyl]-2-methyl-3-[(methylideneamino)methylideneamino]prop-2-enamide |
| SMILES | C=N/C=N/C=C(\C)C(=O)Nc1cccc(OCC(O)CN2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C24H28N4O3/c1-18(13-26-17-25-2)24(30)27-21-8-5-9-23(12-21)31-16-22(29)15-28-11-10-19-6-3-4-7-20(19)14-28/h3-9,12-13,17,22,29H,2,10-11,14-16H2,1H3,(H,27,30)/b18-13+,26-17+ |
| InChIKey | OYPXRLTUHUPIMX-NDRXOFELSA-N |
| XLogP | 3.06 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|