C10H22N4O — CID 129073874
2-[[(1S,2R)-2-(1-aminoethyl)-5-hydroxycyclohexyl]methyl]guanidine (PubChem CID 129073874) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-[[(1S,2R)-2-(1-aminoethyl)-5-hydroxycyclohexyl]methyl]guanidine.
| Compound Name | 2-[[(1S,2R)-2-(1-aminoethyl)-5-hydroxycyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 129073874 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2-[[(1S,2R)-2-(1-aminoethyl)-5-hydroxycyclohexyl]methyl]guanidine |
| SMILES | CC(N)[C@@H]1CCC(O)C[C@@H]1CN=C(N)N |
| InChI | InChI=1S/C10H22N4O/c1-6(11)9-3-2-8(15)4-7(9)5-14-10(12)13/h6-9,15H,2-5,11H2,1H3,(H4,12,13,14)/t6?,7-,8?,9+/m1/s1 |
| InChIKey | XNPSTAZYSVLNOR-VBSAPZBBSA-N |
| XLogP | -0.62 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|