C8H16IN3O — CID 130921427
2-[[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]guanidine;hydroiodide (PubChem CID 130921427) has the molecular formula C8H16IN3O and a molecular weight of 297.14 g/mol. Its IUPAC name is 2-[[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 130921427 |
| Molecular Formula | C8H16IN3O |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 2-[[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]guanidine;hydroiodide |
| SMILES | I.NC(N)=NC[C@H]1C[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C8H15N3O.HI/c9-8(10)11-4-5-3-6-1-2-7(5)12-6;/h5-7H,1-4H2,(H4,9,10,11);1H/t5-,6-,7+;/m1./s1 |
| InChIKey | KDUUDLALJSMSLR-IXUZKAFRSA-N |
| XLogP | 0.45 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|