C11H20N2O — CID 80732154
2,2-dimethyl-N'-(7-oxabicyclo[2.2.1]heptan-2-yl)propanimidamide (PubChem CID 80732154) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 2,2-dimethyl-N'-(7-oxabicyclo[2.2.1]heptan-2-yl)propanimidamide.
| Compound Name | 2,2-dimethyl-N'-(7-oxabicyclo[2.2.1]heptan-2-yl)propanimidamide |
|---|---|
| PubChem CID | 80732154 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2,2-dimethyl-N'-(7-oxabicyclo[2.2.1]heptan-2-yl)propanimidamide |
| SMILES | CC(C)(C)/C(N)=N/C1CC2CCC1O2 |
| InChI | InChI=1S/C11H20N2O/c1-11(2,3)10(12)13-8-6-7-4-5-9(8)14-7/h7-9H,4-6H2,1-3H3,(H2,12,13) |
| InChIKey | HKJZNOZOEIZSIS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|