About 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate
2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 126663970) has the molecular formula C10H16O3S
and a molecular weight of 216.30 g/mol. Its IUPAC name is 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| PubChem CID | 126663970 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CSCCOC(=O)C1CC2CCC1O2 |
| InChI | InChI=1S/C10H16O3S/c1-14-5-4-12-10(11)8-6-7-2-3-9(8)13-7/h7-9H,2-6H2,1H3 |
| InChIKey | QEEBOJBIDGTDDP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate?
The IUPAC name of 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate (CID 126663970) is 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate.
What is the SMILES notation for 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate?
The canonical SMILES for 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate is CSCCOC(=O)C1CC2CCC1O2.
What is the InChIKey of 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate?
The InChIKey is QEEBOJBIDGTDDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3S/c1-14-5-4-12-10(11)8-6-7-2-3-9(8)13-7/h7-9H,2-6H2,1H3.
What are the key properties of 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate?
2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate has a molecular weight of 216.30 g/mol, XLogP of 1.46, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate is sourced from PubChem (CID 126663970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).