C17H26O3 — CID 124734497
[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (1R,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 124734497) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (1R,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (1R,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 124734497 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (1R,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](OC(=O)[C@@H]1C[C@H]3CC[C@H]1O3)C2 |
| InChI | InChI=1S/C17H26O3/c1-16(2)10-6-7-17(16,3)14(8-10)20-15(18)12-9-11-4-5-13(12)19-11/h10-14H,4-9H2,1-3H3/t10-,11+,12+,13+,14+,17-/m0/s1 |
| InChIKey | MJTLELAWWQRNNF-UJNKEFAKSA-N |
| XLogP | 3.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |