C9H15NO3 — CID 58935223
2-aminoethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58935223) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-aminoethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2-aminoethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58935223 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-aminoethyl 7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | NCCOC(=O)C1CC2CCC1O2 |
| InChI | InChI=1S/C9H15NO3/c10-3-4-12-9(11)7-5-6-1-2-8(7)13-6/h6-8H,1-5,10H2 |
| InChIKey | ONSTVYLPWSWCOR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |