C18H21N3O8 — CID 129080418
ethyl 2-[[2-[4-(methoxycarbonylamino)-2-nitrophenyl]-2-oxoethyl]carbamoyl]pent-4-enoate (PubChem CID 129080418) has the molecular formula C18H21N3O8 and a molecular weight of 407.38 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(methoxycarbonylamino)-2-nitrophenyl]-2-oxoethyl]carbamoyl]pent-4-enoate.
| Compound Name | ethyl 2-[[2-[4-(methoxycarbonylamino)-2-nitrophenyl]-2-oxoethyl]carbamoyl]pent-4-enoate |
|---|---|
| PubChem CID | 129080418 |
| Molecular Formula | C18H21N3O8 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | ethyl 2-[[2-[4-(methoxycarbonylamino)-2-nitrophenyl]-2-oxoethyl]carbamoyl]pent-4-enoate |
| SMILES | C=CCC(C(=O)NCC(=O)c1ccc(NC(=O)OC)cc1[N+](=O)[O-])C(=O)OCC |
| InChI | InChI=1S/C18H21N3O8/c1-4-6-13(17(24)29-5-2)16(23)19-10-15(22)12-8-7-11(20-18(25)28-3)9-14(12)21(26)27/h4,7-9,13H,1,5-6,10H2,2-3H3,(H,19,23)(H,20,25) |
| InChIKey | XTGGMFONRXXQRP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|