C27H32F2N4O3 — CID 129080665
[3,9-difluoro-8-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-propan-2-yloxycyclohexyl)methanone (PubChem CID 129080665) has the molecular formula C27H32F2N4O3 and a molecular weight of 498.57 g/mol. Its IUPAC name is [3,9-difluoro-8-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-propan-2-yloxycyclohexyl)methanone.
| Compound Name | [3,9-difluoro-8-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-propan-2-yloxycyclohexyl)methanone |
|---|---|
| PubChem CID | 129080665 |
| Molecular Formula | C27H32F2N4O3 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [3,9-difluoro-8-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-propan-2-yloxycyclohexyl)methanone |
| SMILES | CC(C)OC1CCC(C(=O)N2Cc3cc(F)cnc3Nc3cc(F)c(N4C[C@@H]5C[C@H]4CO5)cc32)CC1 |
| InChI | InChI=1S/C27H32F2N4O3/c1-15(2)36-20-5-3-16(4-6-20)27(34)33-12-17-7-18(28)11-30-26(17)31-23-9-22(29)24(10-25(23)33)32-13-21-8-19(32)14-35-21/h7,9-11,15-16,19-21H,3-6,8,12-14H2,1-2H3,(H,30,31)/t16?,19-,20?,21-/m0/s1 |
| InChIKey | CHNWNUVCJSDKKR-IOXCNKERSA-N |
| XLogP | 4.91 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |