C21H22F3N3O6S — CID 129081280
[(2S,3R)-1-acetyl-2,3-dimethyl-4-(phenylmethoxycarbonylamino)-3,4-dihydro-2H-1,7-naphthyridin-8-yl] trifluoromethanesulfonate (PubChem CID 129081280) has the molecular formula C21H22F3N3O6S and a molecular weight of 501.48 g/mol. Its IUPAC name is [(2S,3R)-1-acetyl-2,3-dimethyl-4-(phenylmethoxycarbonylamino)-3,4-dihydro-2H-1,7-naphthyridin-8-yl] trifluoromethanesulfonate.
| Compound Name | [(2S,3R)-1-acetyl-2,3-dimethyl-4-(phenylmethoxycarbonylamino)-3,4-dihydro-2H-1,7-naphthyridin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 129081280 |
| Molecular Formula | C21H22F3N3O6S |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | [(2S,3R)-1-acetyl-2,3-dimethyl-4-(phenylmethoxycarbonylamino)-3,4-dihydro-2H-1,7-naphthyridin-8-yl] trifluoromethanesulfonate |
| SMILES | CC(=O)N1c2c(ccnc2OS(=O)(=O)C(F)(F)F)C(NC(=O)OCc2ccccc2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C21H22F3N3O6S/c1-12-13(2)27(14(3)28)18-16(9-10-25-19(18)33-34(30,31)21(22,23)24)17(12)26-20(29)32-11-15-7-5-4-6-8-15/h4-10,12-13,17H,11H2,1-3H3,(H,26,29)/t12-,13-,17?/m0/s1 |
| InChIKey | RVEVYEHCMBFKRX-RNWUTADCSA-N |
| XLogP | 3.67 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|