C18H20O3S — CID 129084123
ethyl 2-methoxy-3-methyl-6-(phenylsulfanylmethyl)benzoate (PubChem CID 129084123) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is ethyl 2-methoxy-3-methyl-6-(phenylsulfanylmethyl)benzoate.
| Compound Name | ethyl 2-methoxy-3-methyl-6-(phenylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 129084123 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | ethyl 2-methoxy-3-methyl-6-(phenylsulfanylmethyl)benzoate |
| SMILES | CCOC(=O)c1c(CSc2ccccc2)ccc(C)c1OC |
| InChI | InChI=1S/C18H20O3S/c1-4-21-18(19)16-14(11-10-13(2)17(16)20-3)12-22-15-8-6-5-7-9-15/h5-11H,4,12H2,1-3H3 |
| InChIKey | AMQIOAVQOIDSAN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |