C48H32N6 — CID 129085645
2-phenyl-3-[2-phenyl-1-(6-phenylpyrazin-2-yl)indol-3-yl]-1-(6-phenylpyrazin-2-yl)indole (PubChem CID 129085645) has the molecular formula C48H32N6 and a molecular weight of 692.83 g/mol. Its IUPAC name is 2-phenyl-3-[2-phenyl-1-(6-phenylpyrazin-2-yl)indol-3-yl]-1-(6-phenylpyrazin-2-yl)indole.
| Compound Name | 2-phenyl-3-[2-phenyl-1-(6-phenylpyrazin-2-yl)indol-3-yl]-1-(6-phenylpyrazin-2-yl)indole |
|---|---|
| PubChem CID | 129085645 |
| Molecular Formula | C48H32N6 |
| Molecular Weight | 692.83 g/mol |
| Exact Mass | 692.27 |
| IUPAC Name | 2-phenyl-3-[2-phenyl-1-(6-phenylpyrazin-2-yl)indol-3-yl]-1-(6-phenylpyrazin-2-yl)indole |
| SMILES | c1ccc(-c2cncc(-n3c(-c4ccccc4)c(-c4c(-c5ccccc5)n(-c5cncc(-c6ccccc6)n5)c5ccccc45)c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C48H32N6/c1-5-17-33(18-6-1)39-29-49-31-43(51-39)53-41-27-15-13-25-37(41)45(47(53)35-21-9-3-10-22-35)46-38-26-14-16-28-42(38)54(48(46)36-23-11-4-12-24-36)44-32-50-30-40(52-44)34-19-7-2-8-20-34/h1-32H |
| InChIKey | VVTSJIJVPJBIIL-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.83 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |