C24H17N3 — CID 53254157
2,3-diphenyl-1-pyrazin-2-ylindole (PubChem CID 53254157) has the molecular formula C24H17N3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2,3-diphenyl-1-pyrazin-2-ylindole.
| Compound Name | 2,3-diphenyl-1-pyrazin-2-ylindole |
|---|---|
| PubChem CID | 53254157 |
| Molecular Formula | C24H17N3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2,3-diphenyl-1-pyrazin-2-ylindole |
| SMILES | c1ccc(-c2c(-c3ccccc3)n(-c3cnccn3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H17N3/c1-3-9-18(10-4-1)23-20-13-7-8-14-21(20)27(22-17-25-15-16-26-22)24(23)19-11-5-2-6-12-19/h1-17H |
| InChIKey | YAGOVKBWGMJNSC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |