C26H20N2O — CID 102261827
5-methoxy-2,3-diphenyl-1-pyridin-2-ylindole (PubChem CID 102261827) has the molecular formula C26H20N2O and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-methoxy-2,3-diphenyl-1-pyridin-2-ylindole.
| Compound Name | 5-methoxy-2,3-diphenyl-1-pyridin-2-ylindole |
|---|---|
| PubChem CID | 102261827 |
| Molecular Formula | C26H20N2O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 5-methoxy-2,3-diphenyl-1-pyridin-2-ylindole |
| SMILES | COc1ccc2c(c1)c(-c1ccccc1)c(-c1ccccc1)n2-c1ccccn1 |
| InChI | InChI=1S/C26H20N2O/c1-29-21-15-16-23-22(18-21)25(19-10-4-2-5-11-19)26(20-12-6-3-7-13-20)28(23)24-14-8-9-17-27-24/h2-18H,1H3 |
| InChIKey | JPQCMVNFWHZSGS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |