C50H34N4 — CID 140933249
1-(2,3-diphenyl-1-pyridin-2-ylindol-6-yl)-2,3-diphenyl-6-pyridin-2-ylindole (PubChem CID 140933249) has the molecular formula C50H34N4 and a molecular weight of 690.85 g/mol. Its IUPAC name is 1-(2,3-diphenyl-1-pyridin-2-ylindol-6-yl)-2,3-diphenyl-6-pyridin-2-ylindole.
| Compound Name | 1-(2,3-diphenyl-1-pyridin-2-ylindol-6-yl)-2,3-diphenyl-6-pyridin-2-ylindole |
|---|---|
| PubChem CID | 140933249 |
| Molecular Formula | C50H34N4 |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 1-(2,3-diphenyl-1-pyridin-2-ylindol-6-yl)-2,3-diphenyl-6-pyridin-2-ylindole |
| SMILES | c1ccc(-c2c(-c3ccccc3)n(-c3ccc4c(-c5ccccc5)c(-c5ccccc5)n(-c5ccccn5)c4c3)c3cc(-c4ccccn4)ccc23)cc1 |
| InChI | InChI=1S/C50H34N4/c1-5-17-35(18-6-1)47-41-29-27-39(43-25-13-15-31-51-43)33-44(41)53(49(47)37-21-9-3-10-22-37)40-28-30-42-45(34-40)54(46-26-14-16-32-52-46)50(38-23-11-4-12-24-38)48(42)36-19-7-2-8-20-36/h1-34H |
| InChIKey | UDFSNMDCDNANEX-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |