C15H16N6O — CID 129086082
N-[4-(benzimidazol-1-yl)pyrimidin-2-yl]morpholin-4-amine (PubChem CID 129086082) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[4-(benzimidazol-1-yl)pyrimidin-2-yl]morpholin-4-amine.
| Compound Name | N-[4-(benzimidazol-1-yl)pyrimidin-2-yl]morpholin-4-amine |
|---|---|
| PubChem CID | 129086082 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-[4-(benzimidazol-1-yl)pyrimidin-2-yl]morpholin-4-amine |
| SMILES | c1ccc2c(c1)ncn2-c1ccnc(NN2CCOCC2)n1 |
| InChI | InChI=1S/C15H16N6O/c1-2-4-13-12(3-1)17-11-21(13)14-5-6-16-15(18-14)19-20-7-9-22-10-8-20/h1-6,11H,7-10H2,(H,16,18,19) |
| InChIKey | JHMIOFLCEHMYJG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |