C15H27F3O2 — CID 129087822
(1,1,1-trifluoro-3-hydroperoxy-2,4,4-trimethylhexan-2-yl)cyclohexane (PubChem CID 129087822) has the molecular formula C15H27F3O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-hydroperoxy-2,4,4-trimethylhexan-2-yl)cyclohexane.
| Compound Name | (1,1,1-trifluoro-3-hydroperoxy-2,4,4-trimethylhexan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 129087822 |
| Molecular Formula | C15H27F3O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (1,1,1-trifluoro-3-hydroperoxy-2,4,4-trimethylhexan-2-yl)cyclohexane |
| SMILES | CCC(C)(C)C(OO)C(C)(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C15H27F3O2/c1-5-13(2,3)12(20-19)14(4,15(16,17)18)11-9-7-6-8-10-11/h11-12,19H,5-10H2,1-4H3 |
| InChIKey | RDULFBQKUOELHM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|