About [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate
[2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate (PubChem CID 129088186) has the molecular formula C32H32O5
and a molecular weight of 496.60 g/mol. Its IUPAC name is [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate.
Molecular Properties
| Compound Name | [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate |
| PubChem CID | 129088186 |
| Molecular Formula | C32H32O5 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate |
| SMILES | CC(C)(O)C(OC(=O)COCc1ccccc1)c1ccc(-c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H32O5/c1-32(2,34)31(37-30(33)23-35-21-24-9-5-3-6-10-24)28-15-13-26(14-16-28)27-17-19-29(20-18-27)36-22-25-11-7-4-8-12-25/h3-20,31,34H,21-23H2,1-2H3 |
| InChIKey | HTJNFMVBRAKZFA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate?
The IUPAC name of [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate (CID 129088186) is [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate.
What is the SMILES notation for [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate?
The canonical SMILES for [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate is CC(C)(O)C(OC(=O)COCc1ccccc1)c1ccc(-c2ccc(OCc3ccccc3)cc2)cc1.
What is the InChIKey of [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate?
The InChIKey is HTJNFMVBRAKZFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H32O5/c1-32(2,34)31(37-30(33)23-35-21-24-9-5-3-6-10-24)28-15-13-26(14-16-28)27-17-19-29(20-18-27)36-22-25-11-7-4-8-12-25/h3-20,31,34H,21-23H2,1-2H3.
What are the key properties of [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate?
[2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate has a molecular weight of 496.60 g/mol, XLogP of 6.50, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hydroxy-2-methyl-1-[4-(4-phenylmethoxyphenyl)phenyl]propyl] 2-phenylmethoxyacetate is sourced from PubChem (CID 129088186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).