C19H30F3N — CID 129089871
3-[4-[4-(trifluoromethyl)cyclohexyl]cyclohex-3-en-1-yl]cyclohexan-1-amine (PubChem CID 129089871) has the molecular formula C19H30F3N and a molecular weight of 329.45 g/mol. Its IUPAC name is 3-[4-[4-(trifluoromethyl)cyclohexyl]cyclohex-3-en-1-yl]cyclohexan-1-amine.
| Compound Name | 3-[4-[4-(trifluoromethyl)cyclohexyl]cyclohex-3-en-1-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 129089871 |
| Molecular Formula | C19H30F3N |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | 3-[4-[4-(trifluoromethyl)cyclohexyl]cyclohex-3-en-1-yl]cyclohexan-1-amine |
| SMILES | NC1CCCC(C2CC=C(C3CCC(C(F)(F)F)CC3)CC2)C1 |
| InChI | InChI=1S/C19H30F3N/c20-19(21,22)17-10-8-14(9-11-17)13-4-6-15(7-5-13)16-2-1-3-18(23)12-16/h4,14-18H,1-3,5-12,23H2 |
| InChIKey | QGGKEPZESBLAAX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|