C14H23F2N — CID 90382274
4-[2-(4,5-difluorocyclohexen-1-yl)ethyl]cyclohexan-1-amine (PubChem CID 90382274) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is 4-[2-(4,5-difluorocyclohexen-1-yl)ethyl]cyclohexan-1-amine.
| Compound Name | 4-[2-(4,5-difluorocyclohexen-1-yl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 90382274 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 4-[2-(4,5-difluorocyclohexen-1-yl)ethyl]cyclohexan-1-amine |
| SMILES | NC1CCC(CCC2=CCC(F)C(F)C2)CC1 |
| InChI | InChI=1S/C14H23F2N/c15-13-8-5-11(9-14(13)16)2-1-10-3-6-12(17)7-4-10/h5,10,12-14H,1-4,6-9,17H2 |
| InChIKey | PIRLRPITKJNPEA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|