C13H20F5N — CID 129016724
6-ethyl-2-methyl-4-[(3R)-1,1,1,2,3-pentafluorobutan-2-yl]cyclohex-3-en-1-amine (PubChem CID 129016724) has the molecular formula C13H20F5N and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-ethyl-2-methyl-4-[(3R)-1,1,1,2,3-pentafluorobutan-2-yl]cyclohex-3-en-1-amine.
| Compound Name | 6-ethyl-2-methyl-4-[(3R)-1,1,1,2,3-pentafluorobutan-2-yl]cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 129016724 |
| Molecular Formula | C13H20F5N |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 6-ethyl-2-methyl-4-[(3R)-1,1,1,2,3-pentafluorobutan-2-yl]cyclohex-3-en-1-amine |
| SMILES | CCC1CC(C(F)([C@@H](C)F)C(F)(F)F)=CC(C)C1N |
| InChI | InChI=1S/C13H20F5N/c1-4-9-6-10(5-7(2)11(9)19)12(15,8(3)14)13(16,17)18/h5,7-9,11H,4,6,19H2,1-3H3/t7?,8-,9?,11?,12?/m1/s1 |
| InChIKey | GMEOLPVINJGODJ-WDLWRVTFSA-N |
| XLogP | 3.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|