C15H20O — CID 129091087
6-methyl-10-methylidene-3-propan-2-ylspiro[4.5]deca-3,6-dien-8-one (PubChem CID 129091087) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 6-methyl-10-methylidene-3-propan-2-ylspiro[4.5]deca-3,6-dien-8-one.
| Compound Name | 6-methyl-10-methylidene-3-propan-2-ylspiro[4.5]deca-3,6-dien-8-one |
|---|---|
| PubChem CID | 129091087 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 6-methyl-10-methylidene-3-propan-2-ylspiro[4.5]deca-3,6-dien-8-one |
| SMILES | C=C1CC(=O)C=C(C)C12C=C(C(C)C)CC2 |
| InChI | InChI=1S/C15H20O/c1-10(2)13-5-6-15(9-13)11(3)7-14(16)8-12(15)4/h8-10H,3,5-7H2,1-2,4H3 |
| InChIKey | KKVADEBQFBTUIW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|