C9H16N2O — CID 129095090
2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide (PubChem CID 129095090) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide.
| Compound Name | 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide |
|---|---|
| PubChem CID | 129095090 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide |
| SMILES | C=C/C(=C\CC)N(C)CC(N)=O |
| InChI | InChI=1S/C9H16N2O/c1-4-6-8(5-2)11(3)7-9(10)12/h5-6H,2,4,7H2,1,3H3,(H2,10,12)/b8-6+ |
| InChIKey | UYFLBEXJCUTOQC-SOFGYWHQSA-N |
| XLogP | 0.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|