About 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide
2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide (PubChem CID 129095090) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide.
Molecular Properties
| Compound Name | 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide |
| PubChem CID | 129095090 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide |
| SMILES | C=C/C(=C\CC)N(C)CC(N)=O |
| InChI | InChI=1S/C9H16N2O/c1-4-6-8(5-2)11(3)7-9(10)12/h5-6H,2,4,7H2,1,3H3,(H2,10,12)/b8-6+ |
| InChIKey | UYFLBEXJCUTOQC-SOFGYWHQSA-N |
| XLogP | 0.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide?
The IUPAC name of 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide (CID 129095090) is 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide.
What is the SMILES notation for 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide?
The canonical SMILES for 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide is C=C/C(=C\CC)N(C)CC(N)=O.
What is the InChIKey of 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide?
The InChIKey is UYFLBEXJCUTOQC-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H16N2O/c1-4-6-8(5-2)11(3)7-9(10)12/h5-6H,2,4,7H2,1,3H3,(H2,10,12)/b8-6+.
What are the key properties of 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide?
2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide has a molecular weight of 168.24 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3E)-hexa-1,3-dien-3-yl]-methylamino]acetamide is sourced from PubChem (CID 129095090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).