C14H28F3NOS — CID 129095948
[2-[3,3-dimethyl-4-(trifluoromethyl)hexoxy]-2-methylpropyl]sulfanylmethanamine (PubChem CID 129095948) has the molecular formula C14H28F3NOS and a molecular weight of 315.45 g/mol. Its IUPAC name is [2-[3,3-dimethyl-4-(trifluoromethyl)hexoxy]-2-methylpropyl]sulfanylmethanamine.
| Compound Name | [2-[3,3-dimethyl-4-(trifluoromethyl)hexoxy]-2-methylpropyl]sulfanylmethanamine |
|---|---|
| PubChem CID | 129095948 |
| Molecular Formula | C14H28F3NOS |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [2-[3,3-dimethyl-4-(trifluoromethyl)hexoxy]-2-methylpropyl]sulfanylmethanamine |
| SMILES | CCC(C(F)(F)F)C(C)(C)CCOC(C)(C)CSCN |
| InChI | InChI=1S/C14H28F3NOS/c1-6-11(14(15,16)17)12(2,3)7-8-19-13(4,5)9-20-10-18/h11H,6-10,18H2,1-5H3 |
| InChIKey | JFSJERJIKVTLKL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|