C26H35N3O3S — CID 129098249
N-tert-butylsulfonyl-4-[[4-[(2-phenylcyclopropyl)amino]piperidin-1-yl]methyl]benzamide (PubChem CID 129098249) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is N-tert-butylsulfonyl-4-[[4-[(2-phenylcyclopropyl)amino]piperidin-1-yl]methyl]benzamide.
| Compound Name | N-tert-butylsulfonyl-4-[[4-[(2-phenylcyclopropyl)amino]piperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 129098249 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-tert-butylsulfonyl-4-[[4-[(2-phenylcyclopropyl)amino]piperidin-1-yl]methyl]benzamide |
| SMILES | CC(C)(C)S(=O)(=O)NC(=O)c1ccc(CN2CCC(NC3CC3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H35N3O3S/c1-26(2,3)33(31,32)28-25(30)21-11-9-19(10-12-21)18-29-15-13-22(14-16-29)27-24-17-23(24)20-7-5-4-6-8-20/h4-12,22-24,27H,13-18H2,1-3H3,(H,28,30) |
| InChIKey | AUMNDYYNNGHQNU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |