C25H32N3O3PS — CID 129121949
(E)-3-[4-[[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]methyl]phenyl]-N-(phosphanylmethylsulfonyl)prop-2-enamide (PubChem CID 129121949) has the molecular formula C25H32N3O3PS and a molecular weight of 485.59 g/mol. Its IUPAC name is (E)-3-[4-[[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]methyl]phenyl]-N-(phosphanylmethylsulfonyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]methyl]phenyl]-N-(phosphanylmethylsulfonyl)prop-2-enamide |
|---|---|
| PubChem CID | 129121949 |
| Molecular Formula | C25H32N3O3PS |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | (E)-3-[4-[[4-[[(1R,2S)-2-phenylcyclopropyl]amino]piperidin-1-yl]methyl]phenyl]-N-(phosphanylmethylsulfonyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CN2CCC(N[C@@H]3C[C@H]3c3ccccc3)CC2)cc1)NS(=O)(=O)CP |
| InChI | InChI=1S/C25H32N3O3PS/c29-25(27-33(30,31)18-32)11-10-19-6-8-20(9-7-19)17-28-14-12-22(13-15-28)26-24-16-23(24)21-4-2-1-3-5-21/h1-11,22-24,26H,12-18,32H2,(H,27,29)/b11-10+/t23-,24+/m0/s1 |
| InChIKey | GUMHEAZIABXUHF-CISULEIYSA-N |
| XLogP | 3.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|