C32H36N2O3S — CID 148741721
(E)-N-benzylsulfonyl-3-[4-[[4-[[(1R,2R)-2-phenylcyclopropyl]methyl]piperidin-1-yl]methyl]phenyl]prop-2-enamide (PubChem CID 148741721) has the molecular formula C32H36N2O3S and a molecular weight of 528.72 g/mol. Its IUPAC name is (E)-N-benzylsulfonyl-3-[4-[[4-[[(1R,2R)-2-phenylcyclopropyl]methyl]piperidin-1-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-benzylsulfonyl-3-[4-[[4-[[(1R,2R)-2-phenylcyclopropyl]methyl]piperidin-1-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 148741721 |
| Molecular Formula | C32H36N2O3S |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | (E)-N-benzylsulfonyl-3-[4-[[4-[[(1R,2R)-2-phenylcyclopropyl]methyl]piperidin-1-yl]methyl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CN2CCC(C[C@@H]3C[C@H]3c3ccccc3)CC2)cc1)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C32H36N2O3S/c35-32(33-38(36,37)24-28-7-3-1-4-8-28)16-15-25-11-13-27(14-12-25)23-34-19-17-26(18-20-34)21-30-22-31(30)29-9-5-2-6-10-29/h1-16,26,30-31H,17-24H2,(H,33,35)/b16-15+/t30-,31+/m1/s1 |
| InChIKey | OCYYGLJLQLBTPJ-IMJUGJMKSA-N |
| XLogP | 5.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|