C22H27N — CID 173472767
1-benzyl-4-[[(1R,2R)-2-phenylcyclopropyl]methyl]piperidine (PubChem CID 173472767) has the molecular formula C22H27N and a molecular weight of 305.46 g/mol. Its IUPAC name is 1-benzyl-4-[[(1R,2R)-2-phenylcyclopropyl]methyl]piperidine.
| Compound Name | 1-benzyl-4-[[(1R,2R)-2-phenylcyclopropyl]methyl]piperidine |
|---|---|
| PubChem CID | 173472767 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1-benzyl-4-[[(1R,2R)-2-phenylcyclopropyl]methyl]piperidine |
| SMILES | c1ccc(CN2CCC(C[C@@H]3C[C@H]3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H27N/c1-3-7-19(8-4-1)17-23-13-11-18(12-14-23)15-21-16-22(21)20-9-5-2-6-10-20/h1-10,18,21-22H,11-17H2/t21-,22+/m1/s1 |
| InChIKey | NJONHEJRACJEDS-YADHBBJMSA-N |
| XLogP | 5.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |