C20H23Cl2N3O6 — CID 129099587
5-chloro-6-[4-[(5-chloro-6-ethoxy-3-pyridinyl)carbamoyloxy]-4-methylpentoxy]pyridine-3-carboxylic acid (PubChem CID 129099587) has the molecular formula C20H23Cl2N3O6 and a molecular weight of 472.33 g/mol. Its IUPAC name is 5-chloro-6-[4-[(5-chloro-6-ethoxy-3-pyridinyl)carbamoyloxy]-4-methylpentoxy]pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-[4-[(5-chloro-6-ethoxy-3-pyridinyl)carbamoyloxy]-4-methylpentoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 129099587 |
| Molecular Formula | C20H23Cl2N3O6 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 5-chloro-6-[4-[(5-chloro-6-ethoxy-3-pyridinyl)carbamoyloxy]-4-methylpentoxy]pyridine-3-carboxylic acid |
| SMILES | CCOc1ncc(NC(=O)OC(C)(C)CCCOc2ncc(C(=O)O)cc2Cl)cc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O6/c1-4-29-16-15(22)9-13(11-24-16)25-19(28)31-20(2,3)6-5-7-30-17-14(21)8-12(10-23-17)18(26)27/h8-11H,4-7H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | GFOQHZMWVGCZQH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|