C41H33N5 — CID 129099823
(Z)-1-[4-[1-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)naphthalen-2-yl]phenyl]-4-phenylbut-2-ene-1,4-diimine (PubChem CID 129099823) has the molecular formula C41H33N5 and a molecular weight of 595.75 g/mol. Its IUPAC name is (Z)-1-[4-[1-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)naphthalen-2-yl]phenyl]-4-phenylbut-2-ene-1,4-diimine.
| Compound Name | (Z)-1-[4-[1-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)naphthalen-2-yl]phenyl]-4-phenylbut-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 129099823 |
| Molecular Formula | C41H33N5 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | (Z)-1-[4-[1-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)naphthalen-2-yl]phenyl]-4-phenylbut-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C\C(=N\[H])c1ccc(-c2ccc3ccccc3c2C2NC(c3ccccc3)=NC(c3ccccc3)N2)cc1)c1ccccc1 |
| InChI | InChI=1S/C41H33N5/c42-36(30-13-4-1-5-14-30)26-27-37(43)31-22-20-29(21-23-31)35-25-24-28-12-10-11-19-34(28)38(35)41-45-39(32-15-6-2-7-16-32)44-40(46-41)33-17-8-3-9-18-33/h1-27,39,41-43,45H,(H,44,46)/b27-26-,42-36-,43-37- |
| InChIKey | SBENMPIBJTYSRM-SDRIUPMGSA-N |
| XLogP | 8.84 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|