C40H32IN5 — CID 163832368
2-[4-[4-[4-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]-3-iodoiminoprop-1-en-1-amine (PubChem CID 163832368) has the molecular formula C40H32IN5 and a molecular weight of 709.64 g/mol. Its IUPAC name is 2-[4-[4-[4-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]-3-iodoiminoprop-1-en-1-amine.
| Compound Name | 2-[4-[4-[4-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]-3-iodoiminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 163832368 |
| Molecular Formula | C40H32IN5 |
| Molecular Weight | 709.64 g/mol |
| Exact Mass | 709.17 |
| IUPAC Name | 2-[4-[4-[4-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]phenyl]-3-iodoiminoprop-1-en-1-amine |
| SMILES | NC=C(C=NI)c1ccc(-c2ccc(-c3ccc(C4NC(c5ccccc5)=NC(c5ccccc5)N4)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C40H32IN5/c41-43-26-33(25-42)27-15-17-28(18-16-27)34-23-24-35(37-14-8-7-13-36(34)37)29-19-21-32(22-20-29)40-45-38(30-9-3-1-4-10-30)44-39(46-40)31-11-5-2-6-12-31/h1-26,38,40,45H,42H2,(H,44,46) |
| InChIKey | ULKIXJJZYROIJY-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.64 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|