C40H31N5 — CID 139314716
(Z)-2-[4-[5-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]phenyl]-3-iminoprop-1-en-1-amine (PubChem CID 139314716) has the molecular formula C40H31N5 and a molecular weight of 581.72 g/mol. Its IUPAC name is (Z)-2-[4-[5-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]phenyl]-3-iminoprop-1-en-1-amine.
| Compound Name | (Z)-2-[4-[5-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]phenyl]-3-iminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 139314716 |
| Molecular Formula | C40H31N5 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | (Z)-2-[4-[5-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]phenyl]-3-iminoprop-1-en-1-amine |
| SMILES | [H]/N=C/C(=C\N)c1ccc(-c2cccc3c(-c4ccc(C5=NC(c6ccccc6)NC(c6ccccc6)=N5)cc4)cccc23)cc1 |
| InChI | InChI=1S/C40H31N5/c41-25-33(26-42)27-17-19-28(20-18-27)34-13-7-16-37-35(14-8-15-36(34)37)29-21-23-32(24-22-29)40-44-38(30-9-3-1-4-10-30)43-39(45-40)31-11-5-2-6-12-31/h1-26,38,41H,42H2,(H,43,44,45)/b33-26+,41-25+ |
| InChIKey | KMKKAHNVCGTFEZ-SOAUXUHKSA-N |
| XLogP | 8.62 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|