C42H34N4 — CID 139314463
(1E,3Z)-2-[4-[5-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]phenyl]penta-1,3-dien-1-amine (PubChem CID 139314463) has the molecular formula C42H34N4 and a molecular weight of 594.76 g/mol. Its IUPAC name is (1E,3Z)-2-[4-[5-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]phenyl]penta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-2-[4-[5-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]phenyl]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 139314463 |
| Molecular Formula | C42H34N4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | (1E,3Z)-2-[4-[5-[4-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]phenyl]penta-1,3-dien-1-amine |
| SMILES | C/C=C\C(=C/N)c1ccc(-c2cccc3c(-c4ccc(C5N=C(c6ccccc6)NC(c6ccccc6)=N5)cc4)cccc23)cc1 |
| InChI | InChI=1S/C42H34N4/c1-2-11-35(28-43)29-20-22-30(23-21-29)36-16-9-19-39-37(17-10-18-38(36)39)31-24-26-34(27-25-31)42-45-40(32-12-5-3-6-13-32)44-41(46-42)33-14-7-4-8-15-33/h2-28,42H,43H2,1H3,(H,44,45,46)/b11-2-,35-28+ |
| InChIKey | JOTUUEWBMGIYHJ-ARCLRBFYSA-N |
| XLogP | 9.54 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|