C41H31N5 — CID 139314718
4-[4-[5-[4-(1,4-dihydropyrimidin-2-yl)phenyl]naphthalen-1-yl]phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 139314718) has the molecular formula C41H31N5 and a molecular weight of 593.73 g/mol. Its IUPAC name is 4-[4-[5-[4-(1,4-dihydropyrimidin-2-yl)phenyl]naphthalen-1-yl]phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-[4-[5-[4-(1,4-dihydropyrimidin-2-yl)phenyl]naphthalen-1-yl]phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 139314718 |
| Molecular Formula | C41H31N5 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 4-[4-[5-[4-(1,4-dihydropyrimidin-2-yl)phenyl]naphthalen-1-yl]phenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=CNC(c2ccc(-c3cccc4c(-c5ccc(C6N=C(c7ccccc7)NC(c7ccccc7)=N6)cc5)cccc34)cc2)=NC1 |
| InChI | InChI=1S/C41H31N5/c1-3-10-30(11-4-1)39-44-40(31-12-5-2-6-13-31)46-41(45-39)33-24-20-29(21-25-33)35-15-8-16-36-34(14-7-17-37(35)36)28-18-22-32(23-19-28)38-42-26-9-27-43-38/h1-26,41H,27H2,(H,42,43)(H,44,45,46) |
| InChIKey | MEGWFHIKODAYGX-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 61.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |