C22H27FO5 — CID 129101483
[(2R)-2-(5-fluoro-2-phenylmethoxyphenyl)-2-(2-methoxyethoxy)ethyl] butanoate (PubChem CID 129101483) has the molecular formula C22H27FO5 and a molecular weight of 390.45 g/mol. Its IUPAC name is [(2R)-2-(5-fluoro-2-phenylmethoxyphenyl)-2-(2-methoxyethoxy)ethyl] butanoate.
| Compound Name | [(2R)-2-(5-fluoro-2-phenylmethoxyphenyl)-2-(2-methoxyethoxy)ethyl] butanoate |
|---|---|
| PubChem CID | 129101483 |
| Molecular Formula | C22H27FO5 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [(2R)-2-(5-fluoro-2-phenylmethoxyphenyl)-2-(2-methoxyethoxy)ethyl] butanoate |
| SMILES | CCCC(=O)OC[C@H](OCCOC)c1cc(F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H27FO5/c1-3-7-22(24)28-16-21(26-13-12-25-2)19-14-18(23)10-11-20(19)27-15-17-8-5-4-6-9-17/h4-6,8-11,14,21H,3,7,12-13,15-16H2,1-2H3/t21-/m0/s1 |
| InChIKey | UUZSXDDOMSTORR-NRFANRHFSA-N |
| XLogP | 4.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|