C18H21FO3 — CID 118142400
1-(5-fluoro-2-phenylmethoxyphenyl)pentane-1,3-diol (PubChem CID 118142400) has the molecular formula C18H21FO3 and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-(5-fluoro-2-phenylmethoxyphenyl)pentane-1,3-diol.
| Compound Name | 1-(5-fluoro-2-phenylmethoxyphenyl)pentane-1,3-diol |
|---|---|
| PubChem CID | 118142400 |
| Molecular Formula | C18H21FO3 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-(5-fluoro-2-phenylmethoxyphenyl)pentane-1,3-diol |
| SMILES | CCC(O)CC(O)c1cc(F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H21FO3/c1-2-15(20)11-17(21)16-10-14(19)8-9-18(16)22-12-13-6-4-3-5-7-13/h3-10,15,17,20-21H,2,11-12H2,1H3 |
| InChIKey | NONIJKGVBTXPIA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |