About (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one
(2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one (PubChem CID 129101791) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one.
Molecular Properties
| Compound Name | (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one |
| PubChem CID | 129101791 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one |
| SMILES | CN[C@H](C)C(=O)C(C)(C)CC(C)(C)c1ccncc1 |
| InChI | InChI=1S/C16H26N2O/c1-12(17-6)14(19)16(4,5)11-15(2,3)13-7-9-18-10-8-13/h7-10,12,17H,11H2,1-6H3/t12-/m1/s1 |
| InChIKey | LPMAOIIILKKAII-GFCCVEGCSA-N |
| XLogP | 2.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one?
The IUPAC name of (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one (CID 129101791) is (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one.
What is the SMILES notation for (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one?
The canonical SMILES for (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one is CN[C@H](C)C(=O)C(C)(C)CC(C)(C)c1ccncc1.
What is the InChIKey of (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one?
The InChIKey is LPMAOIIILKKAII-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H26N2O/c1-12(17-6)14(19)16(4,5)11-15(2,3)13-7-9-18-10-8-13/h7-10,12,17H,11H2,1-6H3/t12-/m1/s1.
What are the key properties of (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one?
(2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one has a molecular weight of 262.40 g/mol, XLogP of 2.95, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4,6-trimethyl-2-(methylamino)-6-pyridin-4-ylheptan-3-one is sourced from PubChem (CID 129101791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).