C6H11NO5 — CID 129103368
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-nitrosooxane-3,4-diol (PubChem CID 129103368) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(hydroxymethyl)-5-nitrosooxane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-nitrosooxane-3,4-diol |
|---|---|
| PubChem CID | 129103368 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-nitrosooxane-3,4-diol |
| SMILES | O=N[C@H]1CO[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11NO5/c8-1-4-6(10)5(9)3(7-11)2-12-4/h3-6,8-10H,1-2H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | NCWSBCVQSCHLFJ-SLPGGIOYSA-N |
| XLogP | -1.77 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |