About 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide
2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide (PubChem CID 129104105) has the molecular formula C10H24N6O2+2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide.
Molecular Properties
| Compound Name | 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide |
| PubChem CID | 129104105 |
| Molecular Formula | C10H24N6O2+2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide |
| SMILES | C[N+]1(CC(=O)NN)CC[N+](C)(CC(=O)NN)CC1 |
| InChI | InChI=1S/C10H22N6O2/c1-15(7-9(17)13-11)3-5-16(2,6-4-15)8-10(18)14-12/h3-8,11-12H2,1-2H3/p+2 |
| InChIKey | LDKJMXOGALTIGE-UHFFFAOYSA-P |
| XLogP | -3.13 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide?
The IUPAC name of 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide (CID 129104105) is 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide.
What is the SMILES notation for 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide?
The canonical SMILES for 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide is C[N+]1(CC(=O)NN)CC[N+](C)(CC(=O)NN)CC1.
What is the InChIKey of 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide?
The InChIKey is LDKJMXOGALTIGE-UHFFFAOYSA-P. The full InChI is InChI=1S/C10H22N6O2/c1-15(7-9(17)13-11)3-5-16(2,6-4-15)8-10(18)14-12/h3-8,11-12H2,1-2H3/p+2.
What are the key properties of 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide?
2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide has a molecular weight of 260.34 g/mol, XLogP of -3.13, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide is sourced from PubChem (CID 129104105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).