C10H24N6O2+2 — CID 129104105
2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide (PubChem CID 129104105) has the molecular formula C10H24N6O2+2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide.
| Compound Name | 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 129104105 |
| Molecular Formula | C10H24N6O2+2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetohydrazide |
| SMILES | C[N+]1(CC(=O)NN)CC[N+](C)(CC(=O)NN)CC1 |
| InChI | InChI=1S/C10H22N6O2/c1-15(7-9(17)13-11)3-5-16(2,6-4-15)8-10(18)14-12/h3-8,11-12H2,1-2H3/p+2 |
| InChIKey | LDKJMXOGALTIGE-UHFFFAOYSA-P |
| XLogP | -3.13 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|