About 5-heptylfuran-2-sulfonic acid
5-heptylfuran-2-sulfonic acid (PubChem CID 129105151) has the molecular formula C11H18O4S
and a molecular weight of 246.33 g/mol. Its IUPAC name is 5-heptylfuran-2-sulfonic acid.
Molecular Properties
| Compound Name | 5-heptylfuran-2-sulfonic acid |
| PubChem CID | 129105151 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-heptylfuran-2-sulfonic acid |
| SMILES | CCCCCCCc1ccc(S(=O)(=O)O)o1 |
| InChI | InChI=1S/C11H18O4S/c1-2-3-4-5-6-7-10-8-9-11(15-10)16(12,13)14/h8-9H,2-7H2,1H3,(H,12,13,14) |
| InChIKey | OLFZUXFQVAONDW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-heptylfuran-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-heptylfuran-2-sulfonic acid?
The IUPAC name of 5-heptylfuran-2-sulfonic acid (CID 129105151) is 5-heptylfuran-2-sulfonic acid.
What is the SMILES notation for 5-heptylfuran-2-sulfonic acid?
The canonical SMILES for 5-heptylfuran-2-sulfonic acid is CCCCCCCc1ccc(S(=O)(=O)O)o1.
What is the InChIKey of 5-heptylfuran-2-sulfonic acid?
The InChIKey is OLFZUXFQVAONDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4S/c1-2-3-4-5-6-7-10-8-9-11(15-10)16(12,13)14/h8-9H,2-7H2,1H3,(H,12,13,14).
What are the key properties of 5-heptylfuran-2-sulfonic acid?
5-heptylfuran-2-sulfonic acid has a molecular weight of 246.33 g/mol, XLogP of 3.04, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-heptylfuran-2-sulfonic acid is sourced from PubChem (CID 129105151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).