C9H10N2O3S2 — CID 129105915
4-amino-3-(dithiocarboxyoxymethylamino)benzoic acid (PubChem CID 129105915) has the molecular formula C9H10N2O3S2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-amino-3-(dithiocarboxyoxymethylamino)benzoic acid.
| Compound Name | 4-amino-3-(dithiocarboxyoxymethylamino)benzoic acid |
|---|---|
| PubChem CID | 129105915 |
| Molecular Formula | C9H10N2O3S2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 4-amino-3-(dithiocarboxyoxymethylamino)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)cc1NCOC(=S)S |
| InChI | InChI=1S/C9H10N2O3S2/c10-6-2-1-5(8(12)13)3-7(6)11-4-14-9(15)16/h1-3,11H,4,10H2,(H,12,13)(H,15,16) |
| InChIKey | ONPCYTCORSKEBH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|