C23H31NO6 — CID 129107078
(4S)-4-benzyl-3-[(E,2R)-6-methoxy-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 129107078) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E,2R)-6-methoxy-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E,2R)-6-methoxy-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 129107078 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (4S)-4-benzyl-3-[(E,2R)-6-methoxy-2-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]hex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | COC/C=C/C[C@@H](CCC1(C)OCCO1)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO6/c1-23(29-14-15-30-23)12-11-19(10-6-7-13-27-2)21(25)24-20(17-28-22(24)26)16-18-8-4-3-5-9-18/h3-9,19-20H,10-17H2,1-2H3/b7-6+/t19-,20-/m0/s1 |
| InChIKey | XRSJVSHZUFGVLG-ZBWOGFRMSA-N |
| XLogP | 3.33 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|